|
Synonyms: imidapril hydrochloride
imidapril is an approved drug
Comment: Imidapril is an ACE inhibitor, administered as a prodrug which is then metabolised to the active form, imidaprilat.
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
9
|
|
Hydrogen bond donors
|
2
|
|
Rotatable bonds
|
11
|
|
Topological polar surface area
|
116.25
|
|
Molecular weight
|
405.19
|
|
XLogP
|
1.05
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CCOC(=O)C(NC(C(=O)N1C(=O)N(CC1C(=O)O)C)C)CCc1ccccc1
|
|
Isomeric SMILES
|
CCOC(=O)[C@@H](N[C@H](C(=O)N1C(=O)N(C[C@H]1C(=O)O)C)C)CCc1ccccc1
|
|
InChI
|
InChI=1S/C20H27N3O6/c1-4-29-19(27)15(11-10-14-8-6-5-7-9-14)21-13(2)17(24)23-16(18(25)26)12-22(3)20(23)28/h5-9,13,15-16,21H,4,10-12H2,1-3H3,(H,25,26)/t13-,15-,16-/m0/s1
|
|
InChI Key
|
KLZWOWYOHUKJIG-BPUTZDHNSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|