|
Synonyms: calcitriol hexafluoride | F6-1α,25(OH)2D3 | ST-630
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
3
|
|
Hydrogen bond donors
|
3
|
|
Rotatable bonds
|
8
|
|
Topological polar surface area
|
60.69
|
|
Molecular weight
|
524.27
|
|
XLogP
|
8.75
|
|
No. Lipinski's rules broken
|
1
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OC1CC(O)C(=C)C(=CC=C2CCCC3(C2CCC3C(CCCC(C(F)(F)F)(C(F)(F)F)O)C)C)C1
|
|
Isomeric SMILES
|
O[C@H]1C[C@H](O)C(=C)/C(=C\C=C\2/CCC[C@]3([C@H]2CC[C@@H]3[C@@H](CCCC(C(F)(F)F)(C(F)(F)F)O)C)C)/C1
|
|
InChI
|
InChI=1S/C27H38F6O3/c1-16(6-4-13-25(36,26(28,29)30)27(31,32)33)21-10-11-22-18(7-5-12-24(21,22)3)8-9-19-14-20(34)15-23(35)17(19)2/h8-9,16,20-23,34-36H,2,4-7,10-15H2,1,3H3/b18-8+,19-9-/t16-,20-,21-,22+,23+,24-/m1/s1
|
|
InChI Key
|
XPYGGHVSFMUHLH-UUSULHAXSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|