|
Comment: Negative allosteric modulator of the GLP-1 receptor.
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
7
|
|
Hydrogen bond donors
|
3
|
|
Rotatable bonds
|
11
|
|
Topological polar surface area
|
108.62
|
|
Molecular weight
|
515.21
|
|
XLogP
|
5.38
|
|
No. Lipinski's rules broken
|
1
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OC(=O)CCNC(=O)c1ccc(cc1)C(C1CC(C1)(C)C)Nc1ccc(nc1)n1cnc(c1)C(F)(F)F
|
|
Isomeric SMILES
|
OC(=O)CCNC(=O)c1ccc(cc1)[C@@H](C1CC(C1)(C)C)Nc1ccc(nc1)n1cnc(c1)C(F)(F)F
|
|
InChI
|
InChI=1S/C26H28F3N5O3/c1-25(2)11-18(12-25)23(16-3-5-17(6-4-16)24(37)30-10-9-22(35)36)33-19-7-8-21(31-13-19)34-14-20(32-15-34)26(27,28)29/h3-8,13-15,18,23,33H,9-12H2,1-2H3,(H,30,37)(H,35,36)/t23-/m0/s1
|
|
InChI Key
|
MYZIDYJMNWEJMC-QHCPKHFHSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|