|
Synonyms: PAC-1
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
5
|
|
Hydrogen bond donors
|
2
|
|
Rotatable bonds
|
9
|
|
Topological polar surface area
|
68.17
|
|
Molecular weight
|
392.22
|
|
XLogP
|
3.83
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
C=CCc1cccc(c1O)C=NNC(=O)CN1CCN(CC1)Cc1ccccc1
|
|
Isomeric SMILES
|
C=CCc1cccc(c1O)/C=N\NC(=O)CN1CCN(CC1)Cc1ccccc1
|
|
InChI
|
InChI=1S/C23H28N4O2/c1-2-7-20-10-6-11-21(23(20)29)16-24-25-22(28)18-27-14-12-26(13-15-27)17-19-8-4-3-5-9-19/h2-6,8-11,16,29H,1,7,12-15,17-18H2,(H,25,28)/b24-16-
|
|
InChI Key
|
YQNRVGJCPCNMKT-JLPGSUDCSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|