|
Synonyms: LY 503430 | LY-503,430 | LY-503430
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
5
|
|
Hydrogen bond donors
|
2
|
|
Rotatable bonds
|
8
|
|
Topological polar surface area
|
83.65
|
|
Molecular weight
|
392.16
|
|
XLogP
|
3.63
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CNC(=O)c1ccc(cc1)c1ccc(cc1)C(CNS(=O)(=O)C(C)C)(F)C
|
|
Isomeric SMILES
|
CNC(=O)c1ccc(cc1)c1ccc(cc1)[C@](CNS(=O)(=O)C(C)C)(F)C
|
|
InChI
|
InChI=1S/C20H25FN2O3S/c1-14(2)27(25,26)23-13-20(3,21)18-11-9-16(10-12-18)15-5-7-17(8-6-15)19(24)22-4/h5-12,14,23H,13H2,1-4H3,(H,22,24)/t20-/m0/s1
|
|
InChI Key
|
MFJKNXILEXBWNQ-FQEVSTJZSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|