|
Synonyms: CGP 37849 | CGP-37849
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
6
|
|
Hydrogen bond donors
|
4
|
|
Rotatable bonds
|
4
|
|
Topological polar surface area
|
130.66
|
|
Molecular weight
|
209.05
|
|
XLogP
|
-4.76
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CC(=CC(C(=O)O)N)CP(=O)(O)O
|
|
Isomeric SMILES
|
C/C(=C\C(C(=O)O)N)/CP(=O)(O)O
|
|
InChI
|
InChI=1S/C6H12NO5P/c1-4(3-13(10,11)12)2-5(7)6(8)9/h2,5H,3,7H2,1H3,(H,8,9)(H2,10,11,12)/b4-2+
|
|
InChI Key
|
BDYHNCZIGYIOGJ-DUXPYHPUSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|