|
Synonyms: oxprenoate | RU 28318 | RU-28318
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
4
|
|
Hydrogen bond donors
|
2
|
|
Rotatable bonds
|
5
|
|
Topological polar surface area
|
74.6
|
|
Molecular weight
|
402.28
|
|
XLogP
|
5.17
|
|
No. Lipinski's rules broken
|
1
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CCCC1CC2=CC(=O)CCC2(C2C1C1CCC(C1(CC2)C)(O)CCC(=O)O)C
|
|
Isomeric SMILES
|
CCC[C@@H]1CC2=CC(=O)CC[C@@]2([C@@H]2[C@@H]1[C@@H]1CC[C@@]([C@]1(CC2)C)(O)CCC(=O)O)C
|
|
InChI
|
InChI=1S/C25H38O4/c1-4-5-16-14-17-15-18(26)6-10-23(17,2)19-7-11-24(3)20(22(16)19)8-12-25(24,29)13-9-21(27)28/h15-16,19-20,22,29H,4-14H2,1-3H3,(H,27,28)/t16-,19+,20+,22-,23+,24+,25-/m1/s1
|
|
InChI Key
|
DNHCHRGCTVRAFT-JEHIOXJOSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|