|
Synonyms: RU 26988 | RU-26988
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
3
|
|
Hydrogen bond donors
|
2
|
|
Rotatable bonds
|
0
|
|
Topological polar surface area
|
57.53
|
|
Molecular weight
|
338.19
|
|
XLogP
|
2.73
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CC#CC1(O)CCC2C1(C)CC(O)C1C2C=CC2=CC(=O)C=CC12C
|
|
Isomeric SMILES
|
CC#C[C@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C=CC2=CC(=O)C=C[C@]12C
|
|
InChI
|
InChI=1S/C22H26O3/c1-4-9-22(25)11-8-17-16-6-5-14-12-15(23)7-10-20(14,2)19(16)18(24)13-21(17,22)3/h5-7,10,12,16-19,24-25H,8,11,13H2,1-3H3/t16-,17-,18-,19+,20-,21-,22-/m0/s1
|
|
InChI Key
|
IXJKSIRTUSUXQC-ZXYIWLIBSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|