|
Synonyms: UDP glucuronic acid | UDP-glucuronate | UDPGA | uridine diphosphate glucuronic acid
Compound class:
Metabolite
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
18
|
|
Hydrogen bond donors
|
9
|
|
Rotatable bonds
|
9
|
|
Topological polar surface area
|
333.68
|
|
Molecular weight
|
580.03
|
|
XLogP
|
-5.26
|
|
No. Lipinski's rules broken
|
2
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OC1C(COP(=O)(OP(=O)(OC2OC(C(=O)O)C(C(C2O)O)O)O)O)OC(C1O)n1ccc(=O)[nH]c1=O
|
|
Isomeric SMILES
|
O[C@@H]1[C@@H](COP(=O)(OP(=O)(O[C@H]2O[C@H](C(=O)O)[C@H]([C@@H]([C@H]2O)O)O)O)O)O[C@H]([C@@H]1O)n1ccc(=O)[nH]c1=O
|
|
InChI
|
InChI=1S/C15H22N2O18P2/c18-5-1-2-17(15(26)16-5)12-9(22)6(19)4(32-12)3-31-36(27,28)35-37(29,30)34-14-10(23)7(20)8(21)11(33-14)13(24)25/h1-2,4,6-12,14,19-23H,3H2,(H,24,25)(H,27,28)(H,29,30)(H,16,18,26)/t4-,6-,7+,8+,9-,10-,11+,12-,14-/m1/s1
|
|
InChI Key
|
HDYANYHVCAPMJV-LXQIFKJMSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|