|
Comment: cGMP blocker. Sodium salt is used in assays (compound information is available here: https://pubchem.ncbi.nlm.nih.gov/compound/136240563).
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
8
|
|
Hydrogen bond donors
|
3
|
|
Rotatable bonds
|
1
|
|
Topological polar surface area
|
202.47
|
|
Molecular weight
|
437.93
|
|
XLogP
|
1.53
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
O[C@@H]1[C@@H]2OP(=S)([O-])OC[C@H]2O[C@H]1n1c(Br)nc2c1[nH]c(N)nc2=O
|
|
Isomeric SMILES
|
O[C@@H]1[C@@H]2OP(=S)([O-])OC[C@H]2O[C@H]1n1c(Br)nc2c1[nH]c(N)nc2=O
|
|
InChI
|
InChI=1S/C10H11BrN5O6PS/c11-9-13-3-6(14-10(12)15-7(3)18)16(9)8-4(17)5-2(21-8)1-20-23(19,24)22-5/h2,4-5,8,17H,1H2,(H,19,24)(H3,12,14,15,18)/p-1/t2-,4-,5-,8-,23?/m1/s1
|
|
InChI Key
|
KRYIOQOBMVFLBO-CIZWMVDRSA-M
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|