|
Synonyms: 11-cis-retinol
Compound class:
Metabolite
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
1
|
|
Hydrogen bond donors
|
1
|
|
Rotatable bonds
|
5
|
|
Topological polar surface area
|
20.23
|
|
Molecular weight
|
286.23
|
|
XLogP
|
6.16
|
|
No. Lipinski's rules broken
|
1
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OCC=C(C=CC=C(C=CC1=C(C)CCCC1(C)C)C)C
|
|
Isomeric SMILES
|
OC/C=C(/C=C\C=C(\C=C\C1=C(C)CCCC1(C)C)/C)\C
|
|
InChI
|
InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6-,12-11+,16-8+,17-13+
|
|
InChI Key
|
FPIPGXGPPPQFEQ-IOUUIBBYSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|