| ouabain is an approved drug Compound class: 
                                                            Natural product
                                 
                                    
                                        Comment: Ouabain is a plant derived toxin. It is classified as a cardiac glycoside drug, although due to its high level of toxicity it is generally only used experimentally.
                                    
                                 |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 12 |  
                                                        | Hydrogen bond donors | 8 |  
                                                        | Rotatable bonds | 4 |  
                                                        | Topological polar surface area | 206.6 |  
                                                        | Molecular weight | 584.28 |  
                                                        | XLogP | -0.81 |  
                                                        | No. Lipinski's rules broken | 2 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | OCC12C(O)CC(CC2(O)CCC2C1C(O)CC1(C2(O)CCC1C1=CC(=O)OC1)C)OC1OC(C)C(C(C1O)O)O |  
                                                            | Isomeric SMILES | OC[C@@]12[C@H](O)C[C@@H](C[C@@]2(O)CC[C@@H]2[C@@H]1[C@H](O)C[C@]1([C@]2(O)CC[C@@H]1C1=CC(=O)OC1)C)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |  
                                                            | InChI | InChI=1S/C29H44O12/c1-13-22(34)23(35)24(36)25(40-13)41-15-8-19(32)28(12-30)21-17(3-5-27(28,37)9-15)29(38)6-4-16(14-7-20(33)39-11-14)26(29,2)10-18(21)31/h7,13,15-19,21-25,30-32,34-38H,3-6,8-12H2,1-2H3/t13-,15-,16+,17+,18+,19+,21+,22-,23+,24+,25-,26+,27-,28+,29-/m0/s1 |  
                                                            | InChI Key | LPMXVESGRSUGHW-HBYQJFLCSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |