Compound class:
Metabolite
Comment: Biotin is a water-soluble B-complex vitamin and is an essential co-factor in various metabolic chemical conversions involving biologic carboxylations and the transfer of carbon dioxide. Biotin is critical for cell growth, fatty acid production and fat and amino acid metabolism. Biotin is used as a nutritional supplement, and to correct dietary shortage or imbalance.
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
5
|
|
Hydrogen bond donors
|
3
|
|
Rotatable bonds
|
5
|
|
Topological polar surface area
|
103.73
|
|
Molecular weight
|
244.09
|
|
XLogP
|
0.46
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OC(=O)CCCCC1SCC2C1NC(=O)N2
|
|
Isomeric SMILES
|
OC(=O)CCCC[C@@H]1SC[C@H]2[C@@H]1NC(=O)N2
|
|
InChI
|
InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1
|
|
InChI Key
|
YBJHBAHKTGYVGT-ZKWXMUAHSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|