|
Synonyms: ALG-1001 | ALG1001 | Luminate®
Comment: Risuteganib (ALG-1001) is a hexapeptide intergrin inhibitor [ 3]. It targets multiple integrin heterodimers (αvβ3, αvβ5, α5β1, and α5β3) that are involved in the pathophysiology of retinovascular diseases such as dry age-related macular degeneration and diabetic macular edema [ 1].
|
|
2D Structure
|
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
C[C@H]([C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CS(=O)(=O)O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CN)O
|
|
Isomeric SMILES
|
C[C@H]([C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CS(=O)(=O)O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CN)O
|
|
InChI
|
InChI=1S/C22H39N9O11S/c1-11(32)17(20(37)31-7-3-5-14(31)21(38)39)30-19(36)13(10-43(40,41)42)29-16(34)9-27-18(35)12(28-15(33)8-23)4-2-6-26-22(24)25/h11-14,17,32H,2-10,23H2,1H3,(H,27,35)(H,28,33)(H,29,34)(H,30,36)(H,38,39)(H4,24,25,26)(H,40,41,42)/t11-,12+,13+,14+,17+/m1/s1
|
|
InChI Key
|
MYZAXBZLEILEBR-RVFOSREFSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|